C10H10N2O4S — CID 170484133
5-(3-carboxyprop-1-enyl)-2-methylsulfanylpyrimidine-4-carboxylic acid (PubChem CID 170484133) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is 5-(3-carboxyprop-1-enyl)-2-methylsulfanylpyrimidine-4-carboxylic acid.
| Compound Name | 5-(3-carboxyprop-1-enyl)-2-methylsulfanylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170484133 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(3-carboxyprop-1-enyl)-2-methylsulfanylpyrimidine-4-carboxylic acid |
| SMILES | CSc1ncc(C=CCC(=O)O)c(C(=O)O)n1 |
| InChI | InChI=1S/C10H10N2O4S/c1-17-10-11-5-6(3-2-4-7(13)14)8(12-10)9(15)16/h2-3,5H,4H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | KQFSKWQXZMAFJP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |