C12H16N2O5S2 — CID 171876505
5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methylsulfanylpyrimidine-4-carboxylic acid (PubChem CID 171876505) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methylsulfanylpyrimidine-4-carboxylic acid.
| Compound Name | 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methylsulfanylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 171876505 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)-2-methylsulfanylpyrimidine-4-carboxylic acid |
| SMILES | CSc1ncc(C(O)C(O)CCSC(C)=O)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H16N2O5S2/c1-6(15)21-4-3-8(16)10(17)7-5-13-12(20-2)14-9(7)11(18)19/h5,8,10,16-17H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | MHWDIFDPDGCYDI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|