C28H22N2O2S2 — CID 17048539
N-[(E)-(3-phenoxyphenyl)methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide (PubChem CID 17048539) has the molecular formula C28H22N2O2S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[(E)-(3-phenoxyphenyl)methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide.
| Compound Name | N-[(E)-(3-phenoxyphenyl)methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide |
|---|---|
| PubChem CID | 17048539 |
| Molecular Formula | C28H22N2O2S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[(E)-(3-phenoxyphenyl)methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide |
| SMILES | O=C(C=C(Sc1ccccc1)Sc1ccccc1)N/N=C/c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H22N2O2S2/c31-27(20-28(33-25-15-6-2-7-16-25)34-26-17-8-3-9-18-26)30-29-21-22-11-10-14-24(19-22)32-23-12-4-1-5-13-23/h1-21H,(H,30,31)/b29-21+ |
| InChIKey | DXSPLSROUBJCKA-XHLNEMQHSA-N |
| XLogP | 7.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|