C24H23N3OS2 — CID 41177636
N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide (PubChem CID 41177636) has the molecular formula C24H23N3OS2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide.
| Compound Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide |
|---|---|
| PubChem CID | 41177636 |
| Molecular Formula | C24H23N3OS2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3,3-bis(phenylsulfanyl)prop-2-enamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)C=C(Sc2ccccc2)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3OS2/c1-27(2)20-15-13-19(14-16-20)18-25-26-23(28)17-24(29-21-9-5-3-6-10-21)30-22-11-7-4-8-12-22/h3-18H,1-2H3,(H,26,28)/b25-18- |
| InChIKey | CLWZNOPENVGLKZ-BWAHOGKJSA-N |
| XLogP | 5.63 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|