C16H20N2O6 — CID 170491352
tert-butyl N-[4-(3-formyl-4-hydroxy-5-nitrophenyl)but-3-enyl]carbamate (PubChem CID 170491352) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is tert-butyl N-[4-(3-formyl-4-hydroxy-5-nitrophenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-formyl-4-hydroxy-5-nitrophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491352 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | tert-butyl N-[4-(3-formyl-4-hydroxy-5-nitrophenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1cc(C=O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N2O6/c1-16(2,3)24-15(21)17-7-5-4-6-11-8-12(10-19)14(20)13(9-11)18(22)23/h4,6,8-10,20H,5,7H2,1-3H3,(H,17,21) |
| InChIKey | SZCQZJWPAOPBAS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|