C25H22N2O3 — CID 170492007
9H-fluoren-9-ylmethyl N-[4-(3-formyl-2-pyridinyl)but-3-enyl]carbamate (PubChem CID 170492007) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-formyl-2-pyridinyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-formyl-2-pyridinyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492007 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-formyl-2-pyridinyl)but-3-enyl]carbamate |
| SMILES | O=Cc1cccnc1C=CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22N2O3/c28-16-18-8-7-15-26-24(18)13-5-6-14-27-25(29)30-17-23-21-11-3-1-9-19(21)20-10-2-4-12-22(20)23/h1-5,7-13,15-16,23H,6,14,17H2,(H,27,29) |
| InChIKey | MDNMOUVJNVFWCW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|