C27H26N2O5 — CID 170493161
9H-fluoren-9-ylmethyl N-[4-(2-ethoxy-5-nitrophenyl)but-3-enyl]carbamate (PubChem CID 170493161) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-ethoxy-5-nitrophenyl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-ethoxy-5-nitrophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493161 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-ethoxy-5-nitrophenyl)but-3-enyl]carbamate |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1C=CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H26N2O5/c1-2-33-26-15-14-20(29(31)32)17-19(26)9-7-8-16-28-27(30)34-18-25-23-12-5-3-10-21(23)22-11-4-6-13-24(22)25/h3-7,9-15,17,25H,2,8,16,18H2,1H3,(H,28,30) |
| InChIKey | HVGRJRNWHJKFFT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|