C26H21BrF3NO3 — CID 170493387
9H-fluoren-9-ylmethyl N-[4-[2-bromo-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate (PubChem CID 170493387) has the molecular formula C26H21BrF3NO3 and a molecular weight of 532.36 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[2-bromo-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[2-bromo-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493387 |
| Molecular Formula | C26H21BrF3NO3 |
| Molecular Weight | 532.36 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[2-bromo-4-(trifluoromethoxy)phenyl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1ccc(OC(F)(F)F)cc1Br)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H21BrF3NO3/c27-24-15-18(34-26(28,29)30)13-12-17(24)7-5-6-14-31-25(32)33-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-5,7-13,15,23H,6,14,16H2,(H,31,32) |
| InChIKey | DIJJZPWDNAMBSQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.36 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|