C18H18FN3O4 — CID 170494640
benzyl N-[4-(4-amino-2-fluoro-5-nitrophenyl)but-3-enyl]carbamate (PubChem CID 170494640) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is benzyl N-[4-(4-amino-2-fluoro-5-nitrophenyl)but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-(4-amino-2-fluoro-5-nitrophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494640 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | benzyl N-[4-(4-amino-2-fluoro-5-nitrophenyl)but-3-enyl]carbamate |
| SMILES | Nc1cc(F)c(C=CCCNC(=O)OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18FN3O4/c19-15-11-16(20)17(22(24)25)10-14(15)8-4-5-9-21-18(23)26-12-13-6-2-1-3-7-13/h1-4,6-8,10-11H,5,9,12,20H2,(H,21,23) |
| InChIKey | KKOMJRWOYQOVDD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|