C15H17ClN2 — CID 170500071
1-[3-(4-chlorobut-1-enyl)phenyl]-3,5-dimethylpyrazole (PubChem CID 170500071) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 1-[3-(4-chlorobut-1-enyl)phenyl]-3,5-dimethylpyrazole.
| Compound Name | 1-[3-(4-chlorobut-1-enyl)phenyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 170500071 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-[3-(4-chlorobut-1-enyl)phenyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(-c2cccc(C=CCCCl)c2)n1 |
| InChI | InChI=1S/C15H17ClN2/c1-12-10-13(2)18(17-12)15-8-5-7-14(11-15)6-3-4-9-16/h3,5-8,10-11H,4,9H2,1-2H3 |
| InChIKey | ZBSGHYZIIMWPDK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|