C13H14ClNO3 — CID 170500261
2-[[2-(4-chlorobut-1-enyl)benzoyl]amino]acetic acid (PubChem CID 170500261) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-[[2-(4-chlorobut-1-enyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[[2-(4-chlorobut-1-enyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 170500261 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[[2-(4-chlorobut-1-enyl)benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccccc1C=CCCCl |
| InChI | InChI=1S/C13H14ClNO3/c14-8-4-3-6-10-5-1-2-7-11(10)13(18)15-9-12(16)17/h1-3,5-7H,4,8-9H2,(H,15,18)(H,16,17) |
| InChIKey | NFQIWGIUMVFQFE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|