C23H28N4O2S — CID 170503388
[(1R,6S,8R)-3-azabicyclo[4.2.0]octan-8-yl]-(2-pyrazin-2-ylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone (PubChem CID 170503388) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is [(1R,6S,8R)-3-azabicyclo[4.2.0]octan-8-yl]-(2-pyrazin-2-ylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone.
| Compound Name | [(1R,6S,8R)-3-azabicyclo[4.2.0]octan-8-yl]-(2-pyrazin-2-ylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 170503388 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [(1R,6S,8R)-3-azabicyclo[4.2.0]octan-8-yl]-(2-pyrazin-2-ylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl)methanone |
| SMILES | O=C([C@@H]1C[C@H]2CCNC[C@H]21)N1CCC2(CC1)OCCc1sc(-c3cnccn3)cc12 |
| InChI | InChI=1S/C23H28N4O2S/c28-22(16-11-15-1-5-24-13-17(15)16)27-8-3-23(4-9-27)18-12-21(19-14-25-6-7-26-19)30-20(18)2-10-29-23/h6-7,12,14-17,24H,1-5,8-11,13H2/t15-,16-,17-/m1/s1 |
| InChIKey | AURWEWPEXXGRDR-BRWVUGGUSA-N |
| XLogP | 2.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |