C22H27N5O2S — CID 170508219
[2-(5-aminopyrazin-2-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 170508219) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is [2-(5-aminopyrazin-2-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [2-(5-aminopyrazin-2-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 170508219 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [2-(5-aminopyrazin-2-yl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2S,4R)-7-azabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | Nc1cnc(-c2cc3c(s2)CCOC32CCN(C(=O)[C@H]3C[C@H]4CC[C@@H]3N4)CC2)cn1 |
| InChI | InChI=1S/C22H27N5O2S/c23-20-12-24-17(11-25-20)19-10-15-18(30-19)3-8-29-22(15)4-6-27(7-5-22)21(28)14-9-13-1-2-16(14)26-13/h10-14,16,26H,1-9H2,(H2,23,25)/t13-,14+,16+/m1/s1 |
| InChIKey | RQMXLFQSZGPSOP-YCPHGPKFSA-N |
| XLogP | 2.32 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |