C25H29N3O2S — CID 170512887
[2-(6-amino-2-pyridinyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2R,4S,5R)-3-tricyclo[3.2.1.02,4]octanyl]methanone (PubChem CID 170512887) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is [2-(6-amino-2-pyridinyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2R,4S,5R)-3-tricyclo[3.2.1.02,4]octanyl]methanone.
| Compound Name | [2-(6-amino-2-pyridinyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2R,4S,5R)-3-tricyclo[3.2.1.02,4]octanyl]methanone |
|---|---|
| PubChem CID | 170512887 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [2-(6-amino-2-pyridinyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]-[(1S,2R,4S,5R)-3-tricyclo[3.2.1.02,4]octanyl]methanone |
| SMILES | Nc1cccc(-c2cc3c(s2)CCOC32CCN(C(=O)C3[C@@H]4[C@H]5CC[C@H](C5)[C@H]34)CC2)n1 |
| InChI | InChI=1S/C25H29N3O2S/c26-20-3-1-2-17(27-20)19-13-16-18(31-19)6-11-30-25(16)7-9-28(10-8-25)24(29)23-21-14-4-5-15(12-14)22(21)23/h1-3,13-15,21-23H,4-12H2,(H2,26,27)/t14-,15+,21+,22-,23? |
| InChIKey | HLEZVDDLRZUNPX-BFPMRWPESA-N |
| XLogP | 4.07 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |