C19H25N3O3 — CID 170503707
6-cyclobutyl-4-methyl-N-[(1-methylimidazol-2-yl)methyl]-2-oxo-N-propylpyran-3-carboxamide (PubChem CID 170503707) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-cyclobutyl-4-methyl-N-[(1-methylimidazol-2-yl)methyl]-2-oxo-N-propylpyran-3-carboxamide.
| Compound Name | 6-cyclobutyl-4-methyl-N-[(1-methylimidazol-2-yl)methyl]-2-oxo-N-propylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170503707 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 6-cyclobutyl-4-methyl-N-[(1-methylimidazol-2-yl)methyl]-2-oxo-N-propylpyran-3-carboxamide |
| SMILES | CCCN(Cc1nccn1C)C(=O)c1c(C)cc(C2CCC2)oc1=O |
| InChI | InChI=1S/C19H25N3O3/c1-4-9-22(12-16-20-8-10-21(16)3)18(23)17-13(2)11-15(25-19(17)24)14-6-5-7-14/h8,10-11,14H,4-7,9,12H2,1-3H3 |
| InChIKey | KGRMCFXFKZHOGZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |