C23H24N2O2 — CID 170506236
2-[4-cyclopropyl-2-(3-propan-2-yloxyphenyl)quinolin-6-yl]acetamide (PubChem CID 170506236) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[4-cyclopropyl-2-(3-propan-2-yloxyphenyl)quinolin-6-yl]acetamide.
| Compound Name | 2-[4-cyclopropyl-2-(3-propan-2-yloxyphenyl)quinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 170506236 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[4-cyclopropyl-2-(3-propan-2-yloxyphenyl)quinolin-6-yl]acetamide |
| SMILES | CC(C)Oc1cccc(-c2cc(C3CC3)c3cc(CC(N)=O)ccc3n2)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-14(2)27-18-5-3-4-17(12-18)22-13-19(16-7-8-16)20-10-15(11-23(24)26)6-9-21(20)25-22/h3-6,9-10,12-14,16H,7-8,11H2,1-2H3,(H2,24,26) |
| InChIKey | YYCHXBXISASSKL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |