C22H22N2O3 — CID 170510978
2-[4-cyclopropyl-2-(3,4-dimethoxyphenyl)quinolin-6-yl]acetamide (PubChem CID 170510978) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[4-cyclopropyl-2-(3,4-dimethoxyphenyl)quinolin-6-yl]acetamide.
| Compound Name | 2-[4-cyclopropyl-2-(3,4-dimethoxyphenyl)quinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 170510978 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[4-cyclopropyl-2-(3,4-dimethoxyphenyl)quinolin-6-yl]acetamide |
| SMILES | COc1ccc(-c2cc(C3CC3)c3cc(CC(N)=O)ccc3n2)cc1OC |
| InChI | InChI=1S/C22H22N2O3/c1-26-20-8-6-15(11-21(20)27-2)19-12-16(14-4-5-14)17-9-13(10-22(23)25)3-7-18(17)24-19/h3,6-9,11-12,14H,4-5,10H2,1-2H3,(H2,23,25) |
| InChIKey | UHODHKLSHHCAOH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |