C20H19NO3 — CID 170504904
4-[4-cyclopropyl-7-(hydroxymethyl)quinolin-2-yl]-2-methoxyphenol (PubChem CID 170504904) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[4-cyclopropyl-7-(hydroxymethyl)quinolin-2-yl]-2-methoxyphenol.
| Compound Name | 4-[4-cyclopropyl-7-(hydroxymethyl)quinolin-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 170504904 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[4-cyclopropyl-7-(hydroxymethyl)quinolin-2-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2cc(C3CC3)c3ccc(CO)cc3n2)ccc1O |
| InChI | InChI=1S/C20H19NO3/c1-24-20-9-14(5-7-19(20)23)17-10-16(13-3-4-13)15-6-2-12(11-22)8-18(15)21-17/h2,5-10,13,22-23H,3-4,11H2,1H3 |
| InChIKey | HDPRFBZYZINVRN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |