C19H25N5O3 — CID 170506304
7-[[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-4-methoxyphenyl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 170506304) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 7-[[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-4-methoxyphenyl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-[[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-4-methoxyphenyl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 170506304 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 7-[[3-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-4-methoxyphenyl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | CCn1nc(C)nc1-c1cc(CN2CCN3C(=O)OCC3C2)ccc1OC |
| InChI | InChI=1S/C19H25N5O3/c1-4-24-18(20-13(2)21-24)16-9-14(5-6-17(16)26-3)10-22-7-8-23-15(11-22)12-27-19(23)25/h5-6,9,15H,4,7-8,10-12H2,1-3H3 |
| InChIKey | SVHQXOBVGQSFTG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |