C24H31N3O5 — CID 17050908
4-[2-[2-(2-tert-butylphenoxy)acetyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide (PubChem CID 17050908) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[2-[2-(2-tert-butylphenoxy)acetyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[2-(2-tert-butylphenoxy)acetyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 17050908 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-[2-[2-(2-tert-butylphenoxy)acetyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)NNC(=O)COc2ccccc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-5-31-18-12-10-17(11-13-18)25-21(28)14-15-22(29)26-27-23(30)16-32-20-9-7-6-8-19(20)24(2,3)4/h6-13H,5,14-16H2,1-4H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | KAHMOUZWNYSPBS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|