C14H16F3N3O4 — CID 5118299
N-(4-ethoxyphenyl)-4-oxo-4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]butanamide (PubChem CID 5118299) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-oxo-4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]butanamide.
| Compound Name | N-(4-ethoxyphenyl)-4-oxo-4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]butanamide |
|---|---|
| PubChem CID | 5118299 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-oxo-4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]butanamide |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)NNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N3O4/c1-2-24-10-5-3-9(4-6-10)18-11(21)7-8-12(22)19-20-13(23)14(15,16)17/h3-6H,2,7-8H2,1H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | KJYNINMIESBJAG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|