C20H23N3O5 — CID 2427339
4-[2-[1-(2,4-dihydroxyphenyl)ethenyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide (PubChem CID 2427339) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-[2-[1-(2,4-dihydroxyphenyl)ethenyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide.
| Compound Name | 4-[2-[1-(2,4-dihydroxyphenyl)ethenyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 2427339 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-[2-[1-(2,4-dihydroxyphenyl)ethenyl]hydrazinyl]-N-(4-ethoxyphenyl)-4-oxobutanamide |
| SMILES | C=C(NNC(=O)CCC(=O)Nc1ccc(OCC)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H23N3O5/c1-3-28-16-7-4-14(5-8-16)21-19(26)10-11-20(27)23-22-13(2)17-9-6-15(24)12-18(17)25/h4-9,12,22,24-25H,2-3,10-11H2,1H3,(H,21,26)(H,23,27) |
| InChIKey | PQGQUIXXJZSHKE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|