C17H26N2O4 — CID 17050964
N'-[2-(2-tert-butylphenoxy)acetyl]-3-ethoxypropanehydrazide (PubChem CID 17050964) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N'-[2-(2-tert-butylphenoxy)acetyl]-3-ethoxypropanehydrazide.
| Compound Name | N'-[2-(2-tert-butylphenoxy)acetyl]-3-ethoxypropanehydrazide |
|---|---|
| PubChem CID | 17050964 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N'-[2-(2-tert-butylphenoxy)acetyl]-3-ethoxypropanehydrazide |
| SMILES | CCOCCC(=O)NNC(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-5-22-11-10-15(20)18-19-16(21)12-23-14-9-7-6-8-13(14)17(2,3)4/h6-9H,5,10-12H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | UEAIJIRJDFZFQO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|