C17H19N3O4S — CID 170510419
4-methyl-2-oxo-6-(oxolan-3-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyran-3-carboxamide (PubChem CID 170510419) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 4-methyl-2-oxo-6-(oxolan-3-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyran-3-carboxamide.
| Compound Name | 4-methyl-2-oxo-6-(oxolan-3-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyran-3-carboxamide |
|---|---|
| PubChem CID | 170510419 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-methyl-2-oxo-6-(oxolan-3-yl)-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyran-3-carboxamide |
| SMILES | Cc1cc(C2CCOC2)oc(=O)c1C(=O)Nc1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C17H19N3O4S/c1-9-6-12(10-3-5-23-8-10)24-16(22)14(9)15(21)20-17-19-11-2-4-18-7-13(11)25-17/h6,10,18H,2-5,7-8H2,1H3,(H,19,20,21) |
| InChIKey | DABZXOLLBZVNRG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |