C19H23N5O3S — CID 170513028
N-[7-methoxy-4-methyl-2-[2-(propylamino)pyrimidin-5-yl]quinolin-6-yl]methanesulfonamide (PubChem CID 170513028) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[7-methoxy-4-methyl-2-[2-(propylamino)pyrimidin-5-yl]quinolin-6-yl]methanesulfonamide.
| Compound Name | N-[7-methoxy-4-methyl-2-[2-(propylamino)pyrimidin-5-yl]quinolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 170513028 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[7-methoxy-4-methyl-2-[2-(propylamino)pyrimidin-5-yl]quinolin-6-yl]methanesulfonamide |
| SMILES | CCCNc1ncc(-c2cc(C)c3cc(NS(C)(=O)=O)c(OC)cc3n2)cn1 |
| InChI | InChI=1S/C19H23N5O3S/c1-5-6-20-19-21-10-13(11-22-19)15-7-12(2)14-8-17(24-28(4,25)26)18(27-3)9-16(14)23-15/h7-11,24H,5-6H2,1-4H3,(H,20,21,22) |
| InChIKey | YMLNYSCENIJGMF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |