C18H22N4O5S — CID 171338851
N-[2-(2,3-dimethylimidazol-4-yl)-7-methoxy-4-methylquinolin-6-yl]methanesulfonamide;formic acid (PubChem CID 171338851) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[2-(2,3-dimethylimidazol-4-yl)-7-methoxy-4-methylquinolin-6-yl]methanesulfonamide;formic acid.
| Compound Name | N-[2-(2,3-dimethylimidazol-4-yl)-7-methoxy-4-methylquinolin-6-yl]methanesulfonamide;formic acid |
|---|---|
| PubChem CID | 171338851 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[2-(2,3-dimethylimidazol-4-yl)-7-methoxy-4-methylquinolin-6-yl]methanesulfonamide;formic acid |
| SMILES | COc1cc2nc(-c3cnc(C)n3C)cc(C)c2cc1NS(C)(=O)=O.O=CO |
| InChI | InChI=1S/C17H20N4O3S.CH2O2/c1-10-6-14(16-9-18-11(2)21(16)3)19-13-8-17(24-4)15(7-12(10)13)20-25(5,22)23;2-1-3/h6-9,20H,1-5H3;1H,(H,2,3) |
| InChIKey | GZQSDDPVFYQNAH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|