C20H19N5O3S — CID 171911939
N-[6-methoxy-2-(3-methylimidazol-4-yl)-4-pyridin-4-ylquinolin-7-yl]methanesulfonamide (PubChem CID 171911939) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[6-methoxy-2-(3-methylimidazol-4-yl)-4-pyridin-4-ylquinolin-7-yl]methanesulfonamide.
| Compound Name | N-[6-methoxy-2-(3-methylimidazol-4-yl)-4-pyridin-4-ylquinolin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 171911939 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[6-methoxy-2-(3-methylimidazol-4-yl)-4-pyridin-4-ylquinolin-7-yl]methanesulfonamide |
| SMILES | COc1cc2c(-c3ccncc3)cc(-c3cncn3C)nc2cc1NS(C)(=O)=O |
| InChI | InChI=1S/C20H19N5O3S/c1-25-12-22-11-19(25)17-8-14(13-4-6-21-7-5-13)15-9-20(28-2)18(10-16(15)23-17)24-29(3,26)27/h4-12,24H,1-3H3 |
| InChIKey | DUBCGWHIMRZNCE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |