C24H26ClN3O — CID 170513801
N-[(4aR,6R,8aR)-1-(3-chloro-4-isocyanophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]-4-methylbenzamide (PubChem CID 170513801) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is N-[(4aR,6R,8aR)-1-(3-chloro-4-isocyanophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]-4-methylbenzamide.
| Compound Name | N-[(4aR,6R,8aR)-1-(3-chloro-4-isocyanophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 170513801 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(4aR,6R,8aR)-1-(3-chloro-4-isocyanophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]-4-methylbenzamide |
| SMILES | [C-]#[N+]c1ccc(N2CCC[C@@H]3C[C@H](NC(=O)c4ccc(C)cc4)CC[C@H]32)cc1Cl |
| InChI | InChI=1S/C24H26ClN3O/c1-16-5-7-17(8-6-16)24(29)27-19-9-12-23-18(14-19)4-3-13-28(23)20-10-11-22(26-2)21(25)15-20/h5-8,10-11,15,18-19,23H,3-4,9,12-14H2,1H3,(H,27,29)/t18-,19-,23-/m1/s1 |
| InChIKey | ITEWPNLJNWHXHI-DNVFCKCGSA-N |
| XLogP | 5.77 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|