C30H42N2O4 — CID 17051386
2-(2-tert-butylphenoxy)-N-[2-[[2-(2-tert-butylphenoxy)acetyl]amino]cyclohexyl]acetamide (PubChem CID 17051386) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-[2-[[2-(2-tert-butylphenoxy)acetyl]amino]cyclohexyl]acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-[2-[[2-(2-tert-butylphenoxy)acetyl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 17051386 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-[2-[[2-(2-tert-butylphenoxy)acetyl]amino]cyclohexyl]acetamide |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)NC1CCCCC1NC(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C30H42N2O4/c1-29(2,3)21-13-7-11-17-25(21)35-19-27(33)31-23-15-9-10-16-24(23)32-28(34)20-36-26-18-12-8-14-22(26)30(4,5)6/h7-8,11-14,17-18,23-24H,9-10,15-16,19-20H2,1-6H3,(H,31,33)(H,32,34) |
| InChIKey | NJQXQESGPDXGSY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |