C37H21F6IrN3O3-2 — CID 170514296
iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-3,6-bis(trifluoromethyl)-1H-xanthen-1-id-9-yl]pyridine;pyridine-2-carboxylic acid (PubChem CID 170514296) has the molecular formula C37H21F6IrN3O3-2 and a molecular weight of 861.80 g/mol. Its IUPAC name is iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-3,6-bis(trifluoromethyl)-1H-xanthen-1-id-9-yl]pyridine;pyridine-2-carboxylic acid.
| Compound Name | iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-3,6-bis(trifluoromethyl)-1H-xanthen-1-id-9-yl]pyridine;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170514296 |
| Molecular Formula | C37H21F6IrN3O3-2 |
| Molecular Weight | 861.80 g/mol |
| Exact Mass | 862.11 |
| IUPAC Name | iridium;2-phenyl-6-[(9R)-9-pyridin-2-yl-3,6-bis(trifluoromethyl)-1H-xanthen-1-id-9-yl]pyridine;pyridine-2-carboxylic acid |
| SMILES | FC(F)(F)c1c[c-]c2c(c1)Oc1cc(C(F)(F)F)ccc1[C@]2(c1ccccn1)c1cccc(-c2[c-]cccc2)n1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C31H16F6N2O.C6H5NO2.Ir/c32-30(33,34)20-12-14-22-25(17-20)40-26-18-21(31(35,36)37)13-15-23(26)29(22,27-10-4-5-16-38-27)28-11-6-9-24(39-28)19-7-2-1-3-8-19;8-6(9)5-3-1-2-4-7-5;/h1-7,9-14,16-18H;1-4H,(H,8,9);/q-2;;/t29-;;/m0../s1 |
| InChIKey | BUNDPGQVBGZPTE-UJXPALLWSA-N |
| XLogP | 9.05 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.80 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|