C37H25F4IrN3O3-2 — CID 58914246
bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);3-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium (PubChem CID 58914246) has the molecular formula C37H25F4IrN3O3-2 and a molecular weight of 827.83 g/mol. Its IUPAC name is bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);3-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium.
| Compound Name | bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);3-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium |
|---|---|
| PubChem CID | 58914246 |
| Molecular Formula | C37H25F4IrN3O3-2 |
| Molecular Weight | 827.83 g/mol |
| Exact Mass | 828.15 |
| IUPAC Name | bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);3-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium |
| SMILES | C=Cc1ccc(COc2cccnc2C(=O)O)cc1.Fc1c[c-]c(-c2ccccn2)c(F)c1.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Ir] |
| InChI | InChI=1S/C15H13NO3.2C11H6F2N.Ir/c1-2-11-5-7-12(8-6-11)10-19-13-4-3-9-16-14(13)15(17)18;2*12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h2-9H,1,10H2,(H,17,18);2*1-4,6-7H;/q;2*-1; |
| InChIKey | ICXRBXPCPDMHEA-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.83 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|