C44H42N2 — CID 170514449
2-(3,6-ditert-butyl-10-phenyl-9-pyridin-2-yl-10H-anthracen-9-yl)-6-phenylpyridine (PubChem CID 170514449) has the molecular formula C44H42N2 and a molecular weight of 598.83 g/mol. Its IUPAC name is 2-(3,6-ditert-butyl-10-phenyl-9-pyridin-2-yl-10H-anthracen-9-yl)-6-phenylpyridine.
| Compound Name | 2-(3,6-ditert-butyl-10-phenyl-9-pyridin-2-yl-10H-anthracen-9-yl)-6-phenylpyridine |
|---|---|
| PubChem CID | 170514449 |
| Molecular Formula | C44H42N2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 2-(3,6-ditert-butyl-10-phenyl-9-pyridin-2-yl-10H-anthracen-9-yl)-6-phenylpyridine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1ccccc1)c1cc(C(C)(C)C)ccc1C2(c1ccccn1)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C44H42N2/c1-42(2,3)32-23-25-36-34(28-32)41(31-18-11-8-12-19-31)35-29-33(43(4,5)6)24-26-37(35)44(36,39-21-13-14-27-45-39)40-22-15-20-38(46-40)30-16-9-7-10-17-30/h7-29,41H,1-6H3 |
| InChIKey | OBMRFVQNAYYIMP-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |