C29H36O5SSi — CID 170519410
[6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl] 4-methylbenzenesulfonate (PubChem CID 170519410) has the molecular formula C29H36O5SSi and a molecular weight of 524.76 g/mol. Its IUPAC name is [6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 170519410 |
| Molecular Formula | C29H36O5SSi |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC2)cc1 |
| InChI | InChI=1S/C29H36O5SSi/c1-23-15-19-26(20-16-23)35(30,31)34-25-18-17-24(32-21-25)22-33-36(29(2,3)4,27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-16,19-20,24-25H,17-18,21-22H2,1-4H3 |
| InChIKey | ICIZHYBAGTUKBT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|