C36H50O4SSi — CID 11467580
[(E,2S,6S,8R)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethylnon-3-enyl] 4-methylbenzenesulfonate (PubChem CID 11467580) has the molecular formula C36H50O4SSi and a molecular weight of 606.95 g/mol. Its IUPAC name is [(E,2S,6S,8R)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethylnon-3-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E,2S,6S,8R)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethylnon-3-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11467580 |
| Molecular Formula | C36H50O4SSi |
| Molecular Weight | 606.95 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | [(E,2S,6S,8R)-9-[tert-butyl(diphenyl)silyl]oxy-2,4,6,8-tetramethylnon-3-enyl] 4-methylbenzenesulfonate |
| SMILES | C/C(=C\[C@H](C)COS(=O)(=O)c1ccc(C)cc1)C[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H50O4SSi/c1-28-19-21-33(22-20-28)41(37,38)39-26-31(4)24-29(2)23-30(3)25-32(5)27-40-42(36(6,7)8,34-15-11-9-12-16-34)35-17-13-10-14-18-35/h9-22,24,30-32H,23,25-27H2,1-8H3/b29-24+/t30-,31+,32-/m1/s1 |
| InChIKey | MQEVQELLZKPGPY-SWQKUYTBSA-N |
| XLogP | 7.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.95 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|