C10H11FN2 — CID 170521908
(1S,9R)-5-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 170521908) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is (1S,9R)-5-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9R)-5-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 170521908 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (1S,9R)-5-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Fc1cc2c(cn1)[C@@H]1CC[C@H](C2)N1 |
| InChI | InChI=1S/C10H11FN2/c11-10-4-6-3-7-1-2-9(13-7)8(6)5-12-10/h4-5,7,9,13H,1-3H2/t7-,9+/m1/s1 |
| InChIKey | DWTFTOFWQNDLCA-APPZFPTMSA-N |
| XLogP | 1.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|