C13H18N2S — CID 170522643
7-methyl-3,4-di(propan-2-yl)thieno[2,3-d]pyridazine (PubChem CID 170522643) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 7-methyl-3,4-di(propan-2-yl)thieno[2,3-d]pyridazine.
| Compound Name | 7-methyl-3,4-di(propan-2-yl)thieno[2,3-d]pyridazine |
|---|---|
| PubChem CID | 170522643 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 7-methyl-3,4-di(propan-2-yl)thieno[2,3-d]pyridazine |
| SMILES | Cc1nnc(C(C)C)c2c(C(C)C)csc12 |
| InChI | InChI=1S/C13H18N2S/c1-7(2)10-6-16-13-9(5)14-15-12(8(3)4)11(10)13/h6-8H,1-5H3 |
| InChIKey | MOHWHEYPFMZUNB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |