C16H30O2 — CID 170527496
(2R,7S)-2-propan-2-yl-7-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol (PubChem CID 170527496) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (2R,7S)-2-propan-2-yl-7-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol.
| Compound Name | (2R,7S)-2-propan-2-yl-7-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol |
|---|---|
| PubChem CID | 170527496 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (2R,7S)-2-propan-2-yl-7-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol |
| SMILES | CCC[C@H]1CCC2CC[C@H](C(C)C)C(O)C2C1O |
| InChI | InChI=1S/C16H30O2/c1-4-5-12-7-6-11-8-9-13(10(2)3)16(18)14(11)15(12)17/h10-18H,4-9H2,1-3H3/t11?,12-,13+,14?,15?,16?/m0/s1 |
| InChIKey | OEXRYNPNXMFJHH-LTJIUFDJSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |