C16H30O2 — CID 170527257
(2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol (PubChem CID 170527257) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol.
| Compound Name | (2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 170527257 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (2R)-2,7-di(propan-2-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
| SMILES | CC(C)C1CCCC2C[C@H](C(C)C)C(O)C2C1O |
| InChI | InChI=1S/C16H30O2/c1-9(2)12-7-5-6-11-8-13(10(3)4)16(18)14(11)15(12)17/h9-18H,5-8H2,1-4H3/t11?,12?,13-,14?,15?,16?/m1/s1 |
| InChIKey | REYKGUDSKQWDMC-UNFKKNOASA-N |
| XLogP | 3.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |