C20H38O2 — CID 170527872
(2R)-2,7-di(pentan-3-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol (PubChem CID 170527872) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (2R)-2,7-di(pentan-3-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol.
| Compound Name | (2R)-2,7-di(pentan-3-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 170527872 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (2R)-2,7-di(pentan-3-yl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
| SMILES | CCC(CC)C1CCCC2C[C@H](C(CC)CC)C(O)C2C1O |
| InChI | InChI=1S/C20H38O2/c1-5-13(6-2)16-11-9-10-15-12-17(14(7-3)8-4)20(22)18(15)19(16)21/h13-22H,5-12H2,1-4H3/t15?,16?,17-,18?,19?,20?/m1/s1 |
| InChIKey | KILIWUFYJZZSCC-JNGLLJGYSA-N |
| XLogP | 4.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |