C21H40O2 — CID 170527310
(2S,7R)-7-hexan-3-yl-2-pentan-3-yl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol (PubChem CID 170527310) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is (2S,7R)-7-hexan-3-yl-2-pentan-3-yl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol.
| Compound Name | (2S,7R)-7-hexan-3-yl-2-pentan-3-yl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 170527310 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | (2S,7R)-7-hexan-3-yl-2-pentan-3-yl-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
| SMILES | CCCC(CC)[C@H]1CCCC2C[C@@H](C(CC)CC)C(O)C2C1O |
| InChI | InChI=1S/C21H40O2/c1-5-10-15(8-4)17-12-9-11-16-13-18(14(6-2)7-3)21(23)19(16)20(17)22/h14-23H,5-13H2,1-4H3/t15?,16?,17-,18+,19?,20?,21?/m1/s1 |
| InChIKey | SUPQTGVXHGPIMB-SWNAAPAUSA-N |
| XLogP | 5.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |