C15H28O2 — CID 170527852
2-pentan-3-yl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol (PubChem CID 170527852) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-pentan-3-yl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol.
| Compound Name | 2-pentan-3-yl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol |
|---|---|
| PubChem CID | 170527852 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2-pentan-3-yl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,8-diol |
| SMILES | CCC(CC)C1CCC2CCCC(O)C2C1O |
| InChI | InChI=1S/C15H28O2/c1-3-10(4-2)12-9-8-11-6-5-7-13(16)14(11)15(12)17/h10-17H,3-9H2,1-2H3 |
| InChIKey | YVTKLGUBTZPMRK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |