C34H10N10 — CID 170528805
5-[(Z)-[(8E)-8-[cyano-(3-cyano-2,6-dideuterio-4,5-diisocyanophenyl)methylidene]-4,7-phenanthrolin-3-ylidene]-isocyanomethyl]-4,6-dideuteriobenzene-1,2,3-tricarbonitrile (PubChem CID 170528805) has the molecular formula C34H10N10 and a molecular weight of 562.55 g/mol. Its IUPAC name is 5-[(Z)-[(8E)-8-[cyano-(3-cyano-2,6-dideuterio-4,5-diisocyanophenyl)methylidene]-4,7-phenanthrolin-3-ylidene]-isocyanomethyl]-4,6-dideuteriobenzene-1,2,3-tricarbonitrile.
| Compound Name | 5-[(Z)-[(8E)-8-[cyano-(3-cyano-2,6-dideuterio-4,5-diisocyanophenyl)methylidene]-4,7-phenanthrolin-3-ylidene]-isocyanomethyl]-4,6-dideuteriobenzene-1,2,3-tricarbonitrile |
|---|---|
| PubChem CID | 170528805 |
| Molecular Formula | C34H10N10 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 5-[(Z)-[(8E)-8-[cyano-(3-cyano-2,6-dideuterio-4,5-diisocyanophenyl)methylidene]-4,7-phenanthrolin-3-ylidene]-isocyanomethyl]-4,6-dideuteriobenzene-1,2,3-tricarbonitrile |
| SMILES | [2H]c1c(C#N)c(C#N)c(C#N)c([2H])c1/C([N+]#[C-])=c1\ccc2c(ccc3n/c(=C(/C#N)c4c([2H])c(C#N)c([N+]#[C-])c([N+]#[C-])c4[2H])ccc32)n1 |
| InChI | InChI=1S/C34H10N10/c1-40-32-13-19(10-23(16-37)34(32)42-3)27(18-39)30-6-4-24-25-5-7-31(44-29(25)9-8-28(24)43-30)33(41-2)20-11-21(14-35)26(17-38)22(12-20)15-36/h4-13H/b30-27-,33-31-/i10D,11D,12D,13D |
| InChIKey | LPZOMIPOVFZIQY-OWALAXLXSA-N |
| XLogP | 5.17 |
| TPSA | 157.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|