C31H9N13 — CID 156623570
2-[cyano-[4-[cyano-(5,6-diisocyanobenzimidazol-2-ylidene)methyl]-6-phenyl-1,3,5-triazin-2-yl]methylidene]benzimidazole-5,6-dicarbonitrile (PubChem CID 156623570) has the molecular formula C31H9N13 and a molecular weight of 563.50 g/mol. Its IUPAC name is 2-[cyano-[4-[cyano-(5,6-diisocyanobenzimidazol-2-ylidene)methyl]-6-phenyl-1,3,5-triazin-2-yl]methylidene]benzimidazole-5,6-dicarbonitrile.
| Compound Name | 2-[cyano-[4-[cyano-(5,6-diisocyanobenzimidazol-2-ylidene)methyl]-6-phenyl-1,3,5-triazin-2-yl]methylidene]benzimidazole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 156623570 |
| Molecular Formula | C31H9N13 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 2-[cyano-[4-[cyano-(5,6-diisocyanobenzimidazol-2-ylidene)methyl]-6-phenyl-1,3,5-triazin-2-yl]methylidene]benzimidazole-5,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc2c(cc1[N+]#[C-])=NC(=C(C#N)c1nc(C(C#N)=C3N=c4cc(C#N)c(C#N)cc4=N3)nc(-c3ccccc3)n1)N=2 |
| InChI | InChI=1S/C31H9N13/c1-36-21-10-25-26(11-22(21)37-2)41-29(40-25)20(15-35)31-43-27(16-6-4-3-5-7-16)42-30(44-31)19(14-34)28-38-23-8-17(12-32)18(13-33)9-24(23)39-28/h3-11H |
| InChIKey | OMSIPKAOVHPSJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 191.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|