C23H37NO2 — CID 170530096
3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)pentan-3-yl piperidine-1-carboxylate (PubChem CID 170530096) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)pentan-3-yl piperidine-1-carboxylate.
| Compound Name | 3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)pentan-3-yl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170530096 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 3-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)pentan-3-yl piperidine-1-carboxylate |
| SMILES | CCC(CC)(OC(=O)N1CCCCC1)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C23H37NO2/c1-3-23(4-2,26-22(25)24-10-6-5-7-11-24)19-14-17-13-18(19)21-16-9-8-15(12-16)20(17)21/h15-21H,3-14H2,1-2H3 |
| InChIKey | SAWWJJBPWLQCTE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|