C33H42N6O7 — CID 170532677
2-[2-[[6-[5-[2-[butanoyl(methyl)amino]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-6-oxohexyl]carbamoyloxy]ethoxy]acetic acid (PubChem CID 170532677) has the molecular formula C33H42N6O7 and a molecular weight of 634.73 g/mol. Its IUPAC name is 2-[2-[[6-[5-[2-[butanoyl(methyl)amino]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-6-oxohexyl]carbamoyloxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[[6-[5-[2-[butanoyl(methyl)amino]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-6-oxohexyl]carbamoyloxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 170532677 |
| Molecular Formula | C33H42N6O7 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 2-[2-[[6-[5-[2-[butanoyl(methyl)amino]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-6-oxohexyl]carbamoyloxy]ethoxy]acetic acid |
| SMILES | CCCC(=O)N(C)CCn1nnc2c1-c1ccccc1N(C(=O)CCCCCNC(=O)OCCOCC(=O)O)Cc1ccccc1-2 |
| InChI | InChI=1S/C33H42N6O7/c1-3-11-28(40)37(2)18-19-39-32-26-14-8-9-15-27(26)38(22-24-12-6-7-13-25(24)31(32)35-36-39)29(41)16-5-4-10-17-34-33(44)46-21-20-45-23-30(42)43/h6-9,12-15H,3-5,10-11,16-23H2,1-2H3,(H,34,44)(H,42,43) |
| InChIKey | QITCFRUJZBNNAR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|