C23H41N6O4+3 — CID 170533490
[3-[6-(5-amino-2,4-dioxo-1H-pyrimidin-3-yl)-2-ethyl-5-methylhexyl]-1,1,3-trimethyl-2,4-dioxopyrimidine-1,3-diium-5-yl]-trimethylazanium (PubChem CID 170533490) has the molecular formula C23H41N6O4+3 and a molecular weight of 465.62 g/mol. Its IUPAC name is [3-[6-(5-amino-2,4-dioxo-1H-pyrimidin-3-yl)-2-ethyl-5-methylhexyl]-1,1,3-trimethyl-2,4-dioxopyrimidine-1,3-diium-5-yl]-trimethylazanium.
| Compound Name | [3-[6-(5-amino-2,4-dioxo-1H-pyrimidin-3-yl)-2-ethyl-5-methylhexyl]-1,1,3-trimethyl-2,4-dioxopyrimidine-1,3-diium-5-yl]-trimethylazanium |
|---|---|
| PubChem CID | 170533490 |
| Molecular Formula | C23H41N6O4+3 |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | [3-[6-(5-amino-2,4-dioxo-1H-pyrimidin-3-yl)-2-ethyl-5-methylhexyl]-1,1,3-trimethyl-2,4-dioxopyrimidine-1,3-diium-5-yl]-trimethylazanium |
| SMILES | CCC(CCC(C)Cn1c(=O)[nH]cc(N)c1=O)C[N+]1(C)C(=O)C([N+](C)(C)C)=C[N+](C)(C)C1=O |
| InChI | InChI=1S/C23H40N6O4/c1-9-17(11-10-16(2)13-26-20(30)18(24)12-25-22(26)32)14-29(8)21(31)19(27(3,4)5)15-28(6,7)23(29)33/h12,15-17H,9-11,13-14,24H2,1-8H3/q+2/p+1 |
| InChIKey | XVWLFKNEMLZFCT-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|