C28H29NOS — CID 170545599
4-tert-butyl-9-[4-(2,2-dimethylpropyl)naphthalen-2-yl]-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (PubChem CID 170545599) has the molecular formula C28H29NOS and a molecular weight of 427.61 g/mol. Its IUPAC name is 4-tert-butyl-9-[4-(2,2-dimethylpropyl)naphthalen-2-yl]-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene.
| Compound Name | 4-tert-butyl-9-[4-(2,2-dimethylpropyl)naphthalen-2-yl]-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 170545599 |
| Molecular Formula | C28H29NOS |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-tert-butyl-9-[4-(2,2-dimethylpropyl)naphthalen-2-yl]-3-oxa-7-thia-10-azatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| SMILES | CC(C)(C)Cc1cc(-c2nccc3c2sc2cc(C(C)(C)C)oc23)cc2ccccc12 |
| InChI | InChI=1S/C28H29NOS/c1-27(2,3)16-19-14-18(13-17-9-7-8-10-20(17)19)24-26-21(11-12-29-24)25-22(31-26)15-23(30-25)28(4,5)6/h7-15H,16H2,1-6H3 |
| InChIKey | SWTSQXZFHFHYRG-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |