C31H39N5O2S — CID 170548438
tert-butyl 7-[(7R)-4-(2,3-dimethylphenyl)-7-(4-methyl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 170548438) has the molecular formula C31H39N5O2S and a molecular weight of 545.75 g/mol. Its IUPAC name is tert-butyl 7-[(7R)-4-(2,3-dimethylphenyl)-7-(4-methyl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 7-[(7R)-4-(2,3-dimethylphenyl)-7-(4-methyl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 170548438 |
| Molecular Formula | C31H39N5O2S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | tert-butyl 7-[(7R)-4-(2,3-dimethylphenyl)-7-(4-methyl-1,3-thiazol-5-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | Cc1cccc(-c2nc(N3CCC4(CN(C(=O)OC(C)(C)C)C4)C3)nc3c2CC[C@@H](c2scnc2C)C3)c1C |
| InChI | InChI=1S/C31H39N5O2S/c1-19-8-7-9-23(20(19)2)26-24-11-10-22(27-21(3)32-18-39-27)14-25(24)33-28(34-26)35-13-12-31(15-35)16-36(17-31)29(37)38-30(4,5)6/h7-9,18,22H,10-17H2,1-6H3/t22-/m1/s1 |
| InChIKey | ADSKODCRZJUAHQ-JOCHJYFZSA-N |
| XLogP | 6.25 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |