C23H30N4O3 — CID 69226728
tert-butyl 4-[(4-amino-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl)oxy]piperidine-1-carboxylate (PubChem CID 69226728) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is tert-butyl 4-[(4-amino-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl)oxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-amino-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl)oxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69226728 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl 4-[(4-amino-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-yl)oxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2nc(N)nc3c2CCCc2ccccc2-3)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-23(2,3)30-22(28)27-13-11-16(12-14-27)29-20-18-10-6-8-15-7-4-5-9-17(15)19(18)25-21(24)26-20/h4-5,7,9,16H,6,8,10-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | FFUZOJCFYCUUHK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |