C15H21BN2O2 — CID 170548587
5-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 170548587) has the molecular formula C15H21BN2O2 and a molecular weight of 272.16 g/mol. Its IUPAC name is 5-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | 5-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 170548587 |
| Molecular Formula | C15H21BN2O2 |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CCc1ccc2[nH]ncc2c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H21BN2O2/c1-6-10-7-8-12-11(9-17-18-12)13(10)16-19-14(2,3)15(4,5)20-16/h7-9H,6H2,1-5H3,(H,17,18) |
| InChIKey | FFBULVUNFRRBAW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|